| MolName | 3-(1,3-benzodioxol-5-yl)-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]-1H-pyrazole-5-carboxamide |
| MolecularFormula | C20H16N4O3 |
| Smiles | O=C(c1cc(-c(cc2)cc3c2OCO3)n[nH]1)N/N=C\C=C\c1ccccc1 |
| InChI | InChI=1S/C20H16N4O3/c25-20(24-21-10-4-7-14-5-2-1-3-6-14)17-12-16(22-23-17)15-8-9-18-19(11-15)27-13-26-18/h1-12H,13H2,(H,22,23)(H,24,25) |
| InChIK | CFPITLRUBFWWPK-UHFFFAOYSA-N |
| TotalMolweight | 360.372 |
| Molweight | 360.372 |
| MonoisotopicMass | 360.122241 |
| CLogP | 3.0291 |
| CLogS | -5.099 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 281.84 |
| Relative PSA | 0.28729 |
| PolarSurfaceArea | 88.6 |
| Druglikeness | 5.5039 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 3-(1,3-benzodioxol-5-yl)-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]-1H-pyrazole-5-carboxamide | 2 - 3-(1,3-benzodioxol-5-yl)-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]-1H-pyrazole-5-carboxamide