| MolName | 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-5-phenyltriazole-4-carboxamide |
| MolecularFormula | C29H22N8O3 |
| Smiles | Nc1nonc1-n1nnc(C(N/N=C\c(cc2)ccc2OCc2cccc3ccccc23)=O)c1-c1ccccc1 |
| InChI | InChI=1S/C29H22N8O3/c30-27-28(35-40-34-27)37-26(21-8-2-1-3-9-21)25(32-36-37)29(38)33-31-17-19-13-15-23(16-14-19)39-18-22-11-6-10-20-7-4-5-12-24(20)22/h1-17H,18H2,(H2,30,34)(H,33,38) |
| InChIK | CFXHAWIWOWEHEJ-UHFFFAOYSA-N |
| TotalMolweight | 530.547 |
| Molweight | 530.547 |
| MonoisotopicMass | 530.181487 |
| CLogP | 5.9881 |
| CLogS | -6.153 |
| H Acceptors | 11 |
| H Donors | 2 |
| TotalSurfaceArea | 407.08 |
| Relative PSA | 0.30987 |
| PolarSurfaceArea | 146.34 |
| Druglikeness | 1.7208 |
| Mutagenic | low |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.525 |
| Fragments | 1 |
| Non HAtoms | 40 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 8 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 6 |
| Aromatic Atoms | 32 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 5 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-5-phenyltriazole-4-carboxamide | 2 - 1-(4-amino-1,2,5-oxadiazol-3-yl)-N-[(Z)-[4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-5-phenyltriazole-4-carboxamide