| MolName | 2-(4-chlorophenoxy)-N-[(Z)-[3-nitro-4-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]methylideneamino]acetamide |
| MolecularFormula | C17H13N6O4ClS |
| Smiles | [O-][N+](c(cc(/C=N\NC(COc(cc1)ccc1Cl)=O)cc1)c1Sc1ncn[nH]1)=O |
| InChI | InChI=1S/C17H13ClN6O4S/c18-12-2-4-13(5-3-12)28-9-16(25)22-20-8-11-1-6-15(14(7-11)24(26)27)29-17-19-10-21-23-17/h1-8,10H,9H2,(H,22,25)(H,19,21,23) |
| InChIK | CGBSSNGKFNKHOW-UHFFFAOYSA-N |
| TotalMolweight | 432.847 |
| Molweight | 432.847 |
| MonoisotopicMass | 432.040751 |
| CLogP | 2.294 |
| CLogS | -5.202 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 314.18 |
| Relative PSA | 0.4133 |
| PolarSurfaceArea | 163.38 |
| Druglikeness | -0.16666 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65517 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 4 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-(4-chlorophenoxy)-N-[(Z)-[3-nitro-4-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]methylideneamino]acetamide | 2 - 2-(4-chlorophenoxy)-N-[(Z)-[3-nitro-4-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]methylideneamino]acetamide