| MolName | 4-[(Z)-[4-(1-benzofuran-2-yl)-2-(2,4-difluorophenyl)imino-1,3-thiazol-3-yl]iminomethyl]benzonitrile |
| MolecularFormula | C25H14N4OF2S |
| Smiles | N#Cc1ccc(/C=N\N(C(c2cc(cccc3)c3o2)=CS2)/C2=N/c(ccc(F)c2)c2F)cc1 |
| InChI | InChI=1S/C25H14F2N4OS/c26-19-9-10-21(20(27)12-19)30-25-31(29-14-17-7-5-16(13-28)6-8-17)22(15-33-25)24-11-18-3-1-2-4-23(18)32-24/h1-12,14-15H |
| InChIK | CGUBBNWOEGPTLU-UHFFFAOYSA-N |
| TotalMolweight | 456.475 |
| Molweight | 456.475 |
| MonoisotopicMass | 456.085637 |
| CLogP | 5.9069 |
| CLogS | -8.218 |
| H Acceptors | 5 |
| TotalSurfaceArea | 338.21 |
| Relative PSA | 0.21209 |
| PolarSurfaceArea | 90.19 |
| Druglikeness | -1.7645 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.48485 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 21 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-[4-(1-benzofuran-2-yl)-2-(2,4-difluorophenyl)imino-1,3-thiazol-3-yl]iminomethyl]benzonitrile | 2 - 4-[(Z)-[4-(1-benzofuran-2-yl)-2-(2,4-difluorophenyl)imino-1,3-thiazol-3-yl]iminomethyl]benzonitrile