| MolName | 1-[(Z)-[3-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-3-phenylthiourea |
| MolecularFormula | C21H18N3OFS |
| Smiles | Fc1ccc(COc2cccc(/C=N\NC(Nc3ccccc3)=S)c2)cc1 |
| InChI | InChI=1S/C21H18FN3OS/c22-18-11-9-16(10-12-18)15-26-20-8-4-5-17(13-20)14-23-25-21(27)24-19-6-2-1-3-7-19/h1-14H,15H2,(H2,24,25,27) |
| InChIK | CGUCWBAFCNHNIU-UHFFFAOYSA-N |
| TotalMolweight | 379.458 |
| Molweight | 379.458 |
| MonoisotopicMass | 379.11546 |
| CLogP | 5.0411 |
| CLogS | -5.976 |
| H Acceptors | 4 |
| H Donors | 2 |
| TotalSurfaceArea | 303.28 |
| Relative PSA | 0.23882 |
| PolarSurfaceArea | 77.74 |
| Druglikeness | 0.46209 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.7037 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 3 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - 1-[(Z)-[3-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-3-phenylthiourea | 2 - 1-[(Z)-[3-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-3-phenylthiourea