| MolName | N-[(Z)-3-phenylpropylideneamino]cyclopropanecarboxamide |
| MolecularFormula | C13H16N2O |
| Smiles | O=C(C1CC1)N/N=C\CCc1ccccc1 |
| InChI | InChI=1S/C13H16N2O/c16-13(12-8-9-12)15-14-10-4-7-11-5-2-1-3-6-11/h1-3,5-6,10,12H,4,7-9H2,(H,15,16) |
| InChIK | CHJJSALPSALJHP-UHFFFAOYSA-N |
| TotalMolweight | 216.283 |
| Molweight | 216.283 |
| MonoisotopicMass | 216.126263 |
| CLogP | 2.2175 |
| CLogS | -3.224 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 181.27 |
| Relative PSA | 0.19865 |
| PolarSurfaceArea | 41.46 |
| Druglikeness | 4.6708 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.75 |
| Fragments | 1 |
| Non HAtoms | 16 |
| NonCHAtoms | 3 |
| Electronegative Atoms | 3 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 5 |
| Symmetricatoms | 3 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-3-phenylpropylideneamino]cyclopropanecarboxamide | 2 - N-[(Z)-3-phenylpropylideneamino]cyclopropanecarboxamide