| MolName | N-[(Z)-[1-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-1,2,3,9,10,10a-hexahydrophenanthren-2-yl]methylideneamino]-2,4-dinitroaniline |
| MolecularFormula | C28H24N8O8 |
| Smiles | [O-][N+](c(cc1)cc([N+]([O-])=O)c1N/N=C\C(CC=C(C1CC2)c3c2cccc3)C1/C=N\Nc(ccc([N+]([O-])=O)c1)c1[N+]([O-])=O)=O |
| InChI | InChI=1S/C28H24N8O8/c37-33(38)19-7-11-25(27(13-19)35(41)42)31-29-15-18-6-10-22-21-4-2-1-3-17(21)5-9-23(22)24(18)16-30-32-26-12-8-20(34(39)40)14-28(26)36(43)44/h1-4,7-8,10-16,18,23-24,31-32H,5-6,9H2/b29-15-,30-16? |
| InChIK | CHLYFSJJIDVRRY-FIPFHJCCSA-N |
| TotalMolweight | 600.547 |
| Molweight | 600.547 |
| MonoisotopicMass | 600.171712 |
| CLogP | 4.4611 |
| CLogS | -7.352 |
| H Acceptors | 16 |
| H Donors | 2 |
| TotalSurfaceArea | 436.39 |
| Relative PSA | 0.38411 |
| PolarSurfaceArea | 232.06 |
| Druglikeness | -3.2626 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.45455 |
| Fragments | 1 |
| Non HAtoms | 44 |
| NonCHAtoms | 16 |
| Electronegative Atoms | 16 |
| StereoCenters | 3 |
| Rotatable Bond | 10 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 10 |
| AcidicOxygens | 4 |
| StereoCon | unknown chirality |
Click to Load Molecule:
1 - N-[(Z)-[1-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-1,2,3,9,10,10a-hexahydrophenanthren-2-yl]methylideneamino]-2,4-dinitroaniline | 2 - N-[(Z)-[1-[(Z)-[(2,4-dinitrophenyl)hydrazinylidene]methyl]-1,2,3,9,10,10a-hexahydrophenanthren-2-yl]methylideneamino]-2,4-dinitroaniline