| MolName | 1-(2,4-difluorophenyl)-3-[(Z)-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylideneamino]thiourea |
| MolecularFormula | C21H19N5OF2S2 |
| Smiles | Fc(cc1)cc(F)c1NC(N/N=C\c1c(-c2ccccc2)nc(N2CCOCC2)s1)=S |
| InChI | InChI=1S/C21H19F2N5OS2/c22-15-6-7-17(16(23)12-15)25-20(30)27-24-13-18-19(14-4-2-1-3-5-14)26-21(31-18)28-8-10-29-11-9-28/h1-7,12-13H,8-11H2,(H2,25,27,30) |
| InChIK | CHRSZORFRMHXSZ-UHFFFAOYSA-N |
| TotalMolweight | 459.544 |
| Molweight | 459.544 |
| MonoisotopicMass | 459.099906 |
| CLogP | 4.9205 |
| CLogS | -6.673 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 342.41 |
| Relative PSA | 0.3134 |
| PolarSurfaceArea | 122.11 |
| Druglikeness | 3.3777 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.54839 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 6 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-(2,4-difluorophenyl)-3-[(Z)-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylideneamino]thiourea | 2 - 1-(2,4-difluorophenyl)-3-[(Z)-(2-morpholin-4-yl-4-phenyl-1,3-thiazol-5-yl)methylideneamino]thiourea