| MolName | N-[(Z)-(1,2-diphenylindol-3-yl)methylideneamino]-2-hydroxybenzamide |
| MolecularFormula | C28H21N3O2 |
| Smiles | Oc(cccc1)c1C(N/N=C\c(c1c2cccc1)c(-c1ccccc1)n2-c1ccccc1)=O |
| InChI | InChI=1S/C28H21N3O2/c32-26-18-10-8-16-23(26)28(33)30-29-19-24-22-15-7-9-17-25(22)31(21-13-5-2-6-14-21)27(24)20-11-3-1-4-12-20/h1-19,32H,(H,30,33) |
| InChIK | CHUPGLUILPUEIU-UHFFFAOYSA-N |
| TotalMolweight | 431.494 |
| Molweight | 431.494 |
| MonoisotopicMass | 431.163377 |
| CLogP | 6.1079 |
| CLogS | -9.017 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 336.66 |
| Relative PSA | 0.16628 |
| PolarSurfaceArea | 66.62 |
| Druglikeness | 5.4335 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.45455 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 5 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 27 |
| Sp3Atoms | 1 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(1,2-diphenylindol-3-yl)methylideneamino]-2-hydroxybenzamide | 2 - N-[(Z)-(1,2-diphenylindol-3-yl)methylideneamino]-2-hydroxybenzamide