| MolName | 4-N-(3-bromophenyl)-2-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine |
| MolecularFormula | C20H18N7OBrCl2 |
| Smiles | Clc(ccc(/C=N\Nc1nc(Nc2cccc(Br)c2)nc(N2CCOCC2)n1)c1)c1Cl |
| InChI | InChI=1S/C20H18BrCl2N7O/c21-14-2-1-3-15(11-14)25-18-26-19(28-20(27-18)30-6-8-31-9-7-30)29-24-12-13-4-5-16(22)17(23)10-13/h1-5,10-12H,6-9H2,(H2,25,26,27,28,29) |
| InChIK | CIEYBCODJUHDLS-UHFFFAOYSA-N |
| TotalMolweight | 523.221 |
| Molweight | 523.221 |
| MonoisotopicMass | 521.013323 |
| CLogP | 7.3991 |
| CLogS | -7.322 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 348.05 |
| Relative PSA | 0.23241 |
| PolarSurfaceArea | 87.56 |
| Druglikeness | 1.6515 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.51613 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 5 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 4-N-(3-bromophenyl)-2-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine | 2 - 4-N-(3-bromophenyl)-2-N-[(Z)-(3,4-dichlorophenyl)methylideneamino]-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine