| MolName | [2-[(Z)-[[2-(benzenesulfonamido)acetyl]hydrazinylidene]methyl]-4-bromophenyl] 2-chlorobenzoate |
| MolecularFormula | C22H17N3O5BrClS |
| Smiles | O=C(CNS(c1ccccc1)(=O)=O)N/N=C\c(cc(cc1)Br)c1OC(c(cccc1)c1Cl)=O |
| InChI | InChI=1S/C22H17BrClN3O5S/c23-16-10-11-20(32-22(29)18-8-4-5-9-19(18)24)15(12-16)13-25-27-21(28)14-26-33(30,31)17-6-2-1-3-7-17/h1-13,26H,14H2,(H,27,28) |
| InChIK | CIFXNRXQFYMIIG-UHFFFAOYSA-N |
| TotalMolweight | 550.816 |
| Molweight | 550.816 |
| MonoisotopicMass | 548.97608 |
| CLogP | 4.7336 |
| CLogS | -6.076 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 362.35 |
| Relative PSA | 0.27346 |
| PolarSurfaceArea | 122.31 |
| Druglikeness | -2.7447 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.57576 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 3 |
| Symmetricatoms | 3 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - [2-[(Z)-[[2-(benzenesulfonamido)acetyl]hydrazinylidene]methyl]-4-bromophenyl] 2-chlorobenzoate | 2 - [2-[(Z)-[[2-(benzenesulfonamido)acetyl]hydrazinylidene]methyl]-4-bromophenyl] 2-chlorobenzoate