| MolName | [2-[(Z)-[[8-[(2Z)-2-[[2-(4-chlorobenzoyl)oxyphenyl]methylidene]hydrazinyl]-8-oxooctanoyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
| MolecularFormula | C36H32N4O6Cl2 |
| Smiles | O=C(CCCCCCC(N/N=C\c(cccc1)c1OC(c(cc1)ccc1Cl)=O)=O)N/N=C\c(cccc1)c1OC(c(cc1)ccc1Cl)=O |
| InChI | InChI=1S/C36H32Cl2N4O6/c37-29-19-15-25(16-20-29)35(45)47-31-11-7-5-9-27(31)23-39-41-33(43)13-3-1-2-4-14-34(44)42-40-24-28-10-6-8-12-32(28)48-36(46)26-17-21-30(38)22-18-26/h5-12,15-24H,1-4,13-14H2,(H,41,43)(H,42,44) |
| InChIK | CIMQUUNJAWXTMV-UHFFFAOYSA-N |
| TotalMolweight | 687.578 |
| Molweight | 687.578 |
| MonoisotopicMass | 686.16989 |
| CLogP | 9.3378 |
| CLogS | -10.15 |
| H Acceptors | 10 |
| H Donors | 2 |
| TotalSurfaceArea | 529.38 |
| Relative PSA | 0.22309 |
| PolarSurfaceArea | 135.52 |
| Druglikeness | -4.3681 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 48 |
| NonCHAtoms | 12 |
| Electronegative Atoms | 12 |
| Rotatable Bond | 17 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 8 |
| Symmetricatoms | 26 |
| StereoCon |
Click to Load Molecule:
1 - [2-[(Z)-[[8-[(2Z)-2-[[2-(4-chlorobenzoyl)oxyphenyl]methylidene]hydrazinyl]-8-oxooctanoyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate | 2 - [2-[(Z)-[[8-[(2Z)-2-[[2-(4-chlorobenzoyl)oxyphenyl]methylidene]hydrazinyl]-8-oxooctanoyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate