| MolName | 4-[(Z)-(benzhydrylidenehydrazinylidene)methyl]-N,N-diphenylaniline |
| MolecularFormula | C32H25N3 |
| Smiles | C(c(cc1)ccc1N(c1ccccc1)c1ccccc1)=N\N=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H25N3/c1-5-13-27(14-6-1)32(28-15-7-2-8-16-28)34-33-25-26-21-23-31(24-22-26)35(29-17-9-3-10-18-29)30-19-11-4-12-20-30/h1-25H |
| InChIK | CIOVEVDLIRCVJX-UHFFFAOYSA-N |
| TotalMolweight | 451.572 |
| Molweight | 451.572 |
| MonoisotopicMass | 451.204847 |
| CLogP | 8.5767 |
| CLogS | -10.084 |
| H Acceptors | 3 |
| TotalSurfaceArea | 370.33 |
| Relative PSA | 0.071747 |
| PolarSurfaceArea | 27.96 |
| Druglikeness | 2.9664 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | dimethylene-hydrazine; imine/hydrazone of aldehyde |
| Shape Index | 0.48571 |
| Fragments | 1 |
| Non HAtoms | 35 |
| NonCHAtoms | 3 |
| Electronegative Atoms | 3 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 30 |
| Symmetricatoms | 18 |
| Amines | 1 |
| Aromatic Amines | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(Z)-(benzhydrylidenehydrazinylidene)methyl]-N,N-diphenylaniline | 2 - 4-[(Z)-(benzhydrylidenehydrazinylidene)methyl]-N,N-diphenylaniline