| MolName | 1-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-3-(2-bicyclo[2.2.1]heptanyl)thiourea |
| MolecularFormula | C16H19N3O2S |
| Smiles | S=C(NC1C(CC2)CC2C1)N/N=C\c(cc1)cc2c1OCO2 |
| InChI | InChI=1S/C16H19N3O2S/c22-16(18-13-6-10-1-3-12(13)5-10)19-17-8-11-2-4-14-15(7-11)21-9-20-14/h2,4,7-8,10,12-13H,1,3,5-6,9H2,(H2,18,19,22) |
| InChIK | CIPLAOCVPWWWNA-UHFFFAOYSA-N |
| TotalMolweight | 317.412 |
| Molweight | 317.412 |
| MonoisotopicMass | 317.119797 |
| CLogP | 3.454 |
| CLogS | -5.235 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 239.45 |
| Relative PSA | 0.34425 |
| PolarSurfaceArea | 86.97 |
| Druglikeness | 2.015 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.63636 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| StereoCenters | 3 |
| Rotatable Bond | 3 |
| Rings Closures | 4 |
| Small Rings | 5 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 11 |
| StereoCon | unknown chirality |
Click to Load Molecule:
1 - 1-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-3-(2-bicyclo[2.2.1]heptanyl)thiourea | 2 - 1-[(Z)-1,3-benzodioxol-5-ylmethylideneamino]-3-(2-bicyclo[2.2.1]heptanyl)thiourea