| MolName | N-[(Z)-[4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]pyridine-3-carboxamide |
| MolecularFormula | C20H13N4O4F3 |
| Smiles | [O-][N+](c(cc(C(F)(F)F)cc1)c1Oc1ccc(/C=N\NC(c2cnccc2)=O)cc1)=O |
| InChI | InChI=1S/C20H13F3N4O4/c21-20(22,23)15-5-8-18(17(10-15)27(29)30)31-16-6-3-13(4-7-16)11-25-26-19(28)14-2-1-9-24-12-14/h1-12H,(H,26,28) |
| InChIK | CJCWCACDSNGFPK-UHFFFAOYSA-N |
| TotalMolweight | 430.341 |
| Molweight | 430.341 |
| MonoisotopicMass | 430.08889 |
| CLogP | 3.523 |
| CLogS | -6.461 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 308.64 |
| Relative PSA | 0.28318 |
| PolarSurfaceArea | 109.4 |
| Druglikeness | -8.0495 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.6129 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 7 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 3 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]pyridine-3-carboxamide | 2 - N-[(Z)-[4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methylideneamino]pyridine-3-carboxamide