| MolName | N-[(Z)-(2-chlorophenyl)methylideneamino]-2-(5-piperidin-1-yltetrazol-2-yl)acetamide |
| MolecularFormula | C15H18N7OCl |
| Smiles | O=C(Cn1nnc(N2CCCCC2)n1)N/N=C\c(cccc1)c1Cl |
| InChI | InChI=1S/C15H18ClN7O/c16-13-7-3-2-6-12(13)10-17-18-14(24)11-23-20-15(19-21-23)22-8-4-1-5-9-22/h2-3,6-7,10H,1,4-5,8-9,11H2,(H,18,24) |
| InChIK | CJDBMPRNPBXKGO-UHFFFAOYSA-N |
| TotalMolweight | 347.809 |
| Molweight | 347.809 |
| MonoisotopicMass | 347.126135 |
| CLogP | 2.6784 |
| CLogS | -3.643 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 267.25 |
| Relative PSA | 0.29688 |
| PolarSurfaceArea | 88.3 |
| Druglikeness | 1.0265 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.66667 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 6 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 4 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(2-chlorophenyl)methylideneamino]-2-(5-piperidin-1-yltetrazol-2-yl)acetamide | 2 - N-[(Z)-(2-chlorophenyl)methylideneamino]-2-(5-piperidin-1-yltetrazol-2-yl)acetamide