| MolName | N-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine |
| MolecularFormula | C21H26N7O2Br |
| Smiles | Brc1c(/C=N\Nc2nc(N3CCCCC3)nc(N3CCCCC3)n2)cc2OCOc2c1 |
| InChI | InChI=1S/C21H26BrN7O2/c22-16-12-18-17(30-14-31-18)11-15(16)13-23-27-19-24-20(28-7-3-1-4-8-28)26-21(25-19)29-9-5-2-6-10-29/h11-13H,1-10,14H2,(H,24,25,26,27) |
| InChIK | CKBFIQQFRWYFOH-UHFFFAOYSA-N |
| TotalMolweight | 488.388 |
| Molweight | 488.388 |
| MonoisotopicMass | 487.133134 |
| CLogP | 6.7651 |
| CLogS | -6.864 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 335.61 |
| Relative PSA | 0.24725 |
| PolarSurfaceArea | 88 |
| Druglikeness | 0.6765 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.48387 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 5 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 13 |
| Symmetricatoms | 10 |
| Aromatic Nitrogens | 3 |
| BasicNitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine | 2 - N-[(Z)-(6-bromo-1,3-benzodioxol-5-yl)methylideneamino]-4,6-di(piperidin-1-yl)-1,3,5-triazin-2-amine