| MolName | [1-[(Z)-[[2-[(3,4-dichlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 4-chlorobenzoate |
| MolecularFormula | C27H18N3O4Cl3 |
| Smiles | O=C(CNC(c(cc1)cc(Cl)c1Cl)=O)N/N=C\c(c1ccccc1cc1)c1OC(c(cc1)ccc1Cl)=O |
| InChI | InChI=1S/C27H18Cl3N3O4/c28-19-9-5-17(6-10-19)27(36)37-24-12-8-16-3-1-2-4-20(16)21(24)14-32-33-25(34)15-31-26(35)18-7-11-22(29)23(30)13-18/h1-14H,15H2,(H,31,35)(H,33,34) |
| InChIK | CKRONRPLVUYBRF-UHFFFAOYSA-N |
| TotalMolweight | 554.816 |
| Molweight | 554.816 |
| MonoisotopicMass | 553.036288 |
| CLogP | 6.7282 |
| CLogS | -8.772 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 398.33 |
| Relative PSA | 0.20975 |
| PolarSurfaceArea | 96.86 |
| Druglikeness | 5.1016 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.56757 |
| Fragments | 1 |
| Non HAtoms | 37 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 8 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - [1-[(Z)-[[2-[(3,4-dichlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 4-chlorobenzoate | 2 - [1-[(Z)-[[2-[(3,4-dichlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]naphthalen-2-yl] 4-chlorobenzoate