| MolName | [3-[(Z)-(pyridine-3-carbonylhydrazinylidene)methyl]phenyl] 1,3-benzodioxole-5-carboxylate |
| MolecularFormula | C21H15N3O5 |
| Smiles | O=C(c1cnccc1)N/N=C\c1cccc(OC(c(cc2)cc3c2OCO3)=O)c1 |
| InChI | InChI=1S/C21H15N3O5/c25-20(16-4-2-8-22-12-16)24-23-11-14-3-1-5-17(9-14)29-21(26)15-6-7-18-19(10-15)28-13-27-18/h1-12H,13H2,(H,24,25) |
| InChIK | CKUZHAQBPNMSHQ-UHFFFAOYSA-N |
| TotalMolweight | 389.366 |
| Molweight | 389.366 |
| MonoisotopicMass | 389.101172 |
| CLogP | 3.7426 |
| CLogS | -5.107 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 293.52 |
| Relative PSA | 0.30669 |
| PolarSurfaceArea | 99.11 |
| Druglikeness | 3.954 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.62069 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 4 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - [3-[(Z)-(pyridine-3-carbonylhydrazinylidene)methyl]phenyl] 1,3-benzodioxole-5-carboxylate | 2 - [3-[(Z)-(pyridine-3-carbonylhydrazinylidene)methyl]phenyl] 1,3-benzodioxole-5-carboxylate