| MolName | [3-[(Z)-[[2-[(2-chlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate |
| MolecularFormula | C23H17N3O4Cl2 |
| Smiles | O=C(CNC(c(cccc1)c1Cl)=O)N/N=C\c1cc(OC(c(cc2)ccc2Cl)=O)ccc1 |
| InChI | InChI=1S/C23H17Cl2N3O4/c24-17-10-8-16(9-11-17)23(31)32-18-5-3-4-15(12-18)13-27-28-21(29)14-26-22(30)19-6-1-2-7-20(19)25/h1-13H,14H2,(H,26,30)(H,28,29) |
| InChIK | CKXRRIQUFUJJCS-UHFFFAOYSA-N |
| TotalMolweight | 470.311 |
| Molweight | 470.311 |
| MonoisotopicMass | 469.059611 |
| CLogP | 4.9278 |
| CLogS | -6.43 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 348.31 |
| Relative PSA | 0.23987 |
| PolarSurfaceArea | 96.86 |
| Druglikeness | 5.1016 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.65625 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 2 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - [3-[(Z)-[[2-[(2-chlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate | 2 - [3-[(Z)-[[2-[(2-chlorobenzoyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 4-chlorobenzoate