| MolName | N-[(Z)-[3,4-bis(phenylmethoxy)phenyl]methylideneamino]pyridine-3-carboxamide |
| MolecularFormula | C27H23N3O3 |
| Smiles | O=C(c1cnccc1)N/N=C\c(cc1)cc(OCc2ccccc2)c1OCc1ccccc1 |
| InChI | InChI=1S/C27H23N3O3/c31-27(24-12-7-15-28-18-24)30-29-17-23-13-14-25(32-19-21-8-3-1-4-9-21)26(16-23)33-20-22-10-5-2-6-11-22/h1-18H,19-20H2,(H,30,31) |
| InChIK | CLBOHBQMPLYJEM-UHFFFAOYSA-N |
| TotalMolweight | 437.498 |
| Molweight | 437.498 |
| MonoisotopicMass | 437.173942 |
| CLogP | 4.8969 |
| CLogS | -5.608 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 352.79 |
| Relative PSA | 0.18986 |
| PolarSurfaceArea | 72.81 |
| Druglikeness | 4.0205 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.54545 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 9 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 4 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[3,4-bis(phenylmethoxy)phenyl]methylideneamino]pyridine-3-carboxamide | 2 - N-[(Z)-[3,4-bis(phenylmethoxy)phenyl]methylideneamino]pyridine-3-carboxamide