| MolName | 2-benzyl-5-[(4-chlorophenyl)methyl]-4-[(Z)-naphthalen-1-ylmethylideneamino]-1,2,4-triazol-3-one |
| MolecularFormula | C27H21N4OCl |
| Smiles | O=C(N(Cc1ccccc1)N=C1Cc(cc2)ccc2Cl)N1/N=C\c1cccc2ccccc12 |
| InChI | InChI=1S/C27H21ClN4O/c28-24-15-13-20(14-16-24)17-26-30-31(19-21-7-2-1-3-8-21)27(33)32(26)29-18-23-11-6-10-22-9-4-5-12-25(22)23/h1-16,18H,17,19H2 |
| InChIK | CLHSQTNWOHESLV-UHFFFAOYSA-N |
| TotalMolweight | 452.944 |
| Molweight | 452.944 |
| MonoisotopicMass | 452.140388 |
| CLogP | 6.1941 |
| CLogS | -7.492 |
| H Acceptors | 5 |
| TotalSurfaceArea | 342.9 |
| Relative PSA | 0.12587 |
| PolarSurfaceArea | 48.27 |
| Druglikeness | 4.5415 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.45455 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - 2-benzyl-5-[(4-chlorophenyl)methyl]-4-[(Z)-naphthalen-1-ylmethylideneamino]-1,2,4-triazol-3-one | 2 - 2-benzyl-5-[(4-chlorophenyl)methyl]-4-[(Z)-naphthalen-1-ylmethylideneamino]-1,2,4-triazol-3-one