| MolName | 4-[(Z)-[5-(2-nitrophenyl)furan-2-yl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| MolecularFormula | C20H15N3O5 |
| Smiles | [O-][N+](c(cccc1)c1-c1ccc(/C=N\N(C(C2C3C4C=CC2C4)=O)C3=O)o1)=O |
| InChI | InChI=1S/C20H15N3O5/c24-19-17-11-5-6-12(9-11)18(17)20(25)22(19)21-10-13-7-8-16(28-13)14-3-1-2-4-15(14)23(26)27/h1-8,10-12,17-18H,9H2 |
| InChIK | CLJNOVYGQFYBJS-UHFFFAOYSA-N |
| TotalMolweight | 377.355 |
| Molweight | 377.355 |
| MonoisotopicMass | 377.101172 |
| CLogP | 1.7558 |
| CLogS | -5.188 |
| H Acceptors | 8 |
| TotalSurfaceArea | 266.7 |
| Relative PSA | 0.32122 |
| PolarSurfaceArea | 108.7 |
| Druglikeness | 2.0256 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | low |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.5 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| StereoCenters | 4 |
| Rotatable Bond | 4 |
| Rings Closures | 5 |
| Small Rings | 6 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 6 |
| Symmetricatoms | 5 |
| AcidicOxygens | 1 |
| StereoCon | unknown chirality |
Click to Load Molecule:
1 - 4-[(Z)-[5-(2-nitrophenyl)furan-2-yl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione | 2 - 4-[(Z)-[5-(2-nitrophenyl)furan-2-yl]methylideneamino]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione