| MolName | 2-[(Z)-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]methylideneamino]isoindole-1,3-dione |
| MolecularFormula | C26H16N4O3 |
| Smiles | O=C(c(cccc1)c1C1=O)N1/N=C\c1cn(-c2ccccc2)nc1-c1cc(cccc2)c2o1 |
| InChI | InChI=1S/C26H16N4O3/c31-25-20-11-5-6-12-21(20)26(32)30(25)27-15-18-16-29(19-9-2-1-3-10-19)28-24(18)23-14-17-8-4-7-13-22(17)33-23/h1-16H |
| InChIK | CLXSHNBQCKUWRT-UHFFFAOYSA-N |
| TotalMolweight | 432.438 |
| Molweight | 432.438 |
| MonoisotopicMass | 432.122241 |
| CLogP | 4.1133 |
| CLogS | -5.946 |
| H Acceptors | 7 |
| TotalSurfaceArea | 321.85 |
| Relative PSA | 0.22709 |
| PolarSurfaceArea | 80.7 |
| Druglikeness | 4.312 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.42424 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 4 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 26 |
| Symmetricatoms | 7 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(Z)-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]methylideneamino]isoindole-1,3-dione | 2 - 2-[(Z)-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]methylideneamino]isoindole-1,3-dione