| MolName | 2-amino-1-[(Z)-(3-bromophenyl)methylideneamino]-N-phenylpyrrolo[3,2-b]quinoxaline-3-carboxamide |
| MolecularFormula | C24H17N6OBr |
| Smiles | Nc1c(C(Nc2ccccc2)=O)c2nc3ccccc3nc2n1/N=C\c1cccc(Br)c1 |
| InChI | InChI=1S/C24H17BrN6O/c25-16-8-6-7-15(13-16)14-27-31-22(26)20(24(32)28-17-9-2-1-3-10-17)21-23(31)30-19-12-5-4-11-18(19)29-21/h1-14H,26H2,(H,28,32) |
| InChIK | CMCJVDJCBGOUPW-UHFFFAOYSA-N |
| TotalMolweight | 485.344 |
| Molweight | 485.344 |
| MonoisotopicMass | 484.06472 |
| CLogP | 4.8876 |
| CLogS | -9.378 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 329.82 |
| Relative PSA | 0.24283 |
| PolarSurfaceArea | 98.19 |
| Druglikeness | 3.8547 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.46875 |
| Fragments | 1 |
| Non HAtoms | 32 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 4 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 25 |
| Sp3Atoms | 1 |
| Symmetricatoms | 2 |
| Amides | 1 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - 2-amino-1-[(Z)-(3-bromophenyl)methylideneamino]-N-phenylpyrrolo[3,2-b]quinoxaline-3-carboxamide | 2 - 2-amino-1-[(Z)-(3-bromophenyl)methylideneamino]-N-phenylpyrrolo[3,2-b]quinoxaline-3-carboxamide