| MolName | N-[(Z)-(1,3-diphenylpyrazol-4-yl)methylideneamino]-3-morpholin-4-ylsulfonylbenzamide |
| MolecularFormula | C27H25N5O4S |
| Smiles | O=C(c1cccc(S(N2CCOCC2)(=O)=O)c1)N/N=C\c1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C27H25N5O4S/c33-27(22-10-7-13-25(18-22)37(34,35)31-14-16-36-17-15-31)29-28-19-23-20-32(24-11-5-2-6-12-24)30-26(23)21-8-3-1-4-9-21/h1-13,18-20H,14-17H2,(H,29,33) |
| InChIK | CMMYQELZNZPRAG-UHFFFAOYSA-N |
| TotalMolweight | 515.592 |
| Molweight | 515.592 |
| MonoisotopicMass | 515.162725 |
| CLogP | 3.1634 |
| CLogS | -4.44 |
| H Acceptors | 9 |
| H Donors | 1 |
| TotalSurfaceArea | 384.89 |
| Relative PSA | 0.24937 |
| PolarSurfaceArea | 114.27 |
| Druglikeness | 2.1926 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.51351 |
| Fragments | 1 |
| Non HAtoms | 37 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 6 |
| Symmetricatoms | 7 |
| Amides | 1 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(1,3-diphenylpyrazol-4-yl)methylideneamino]-3-morpholin-4-ylsulfonylbenzamide | 2 - N-[(Z)-(1,3-diphenylpyrazol-4-yl)methylideneamino]-3-morpholin-4-ylsulfonylbenzamide