| MolName | 2-[2-[(Z)-[[2-[[4-(4-chlorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]phenoxy]acetic acid |
| MolecularFormula | C25H20N5O4ClS |
| Smiles | OC(COc1c(/C=N\NC(CSc2nnc(-c3ccccc3)n2-c(cc2)ccc2Cl)=O)cccc1)=O |
| InChI | InChI=1S/C25H20ClN5O4S/c26-19-10-12-20(13-11-19)31-24(17-6-2-1-3-7-17)29-30-25(31)36-16-22(32)28-27-14-18-8-4-5-9-21(18)35-15-23(33)34/h1-14H,15-16H2,(H,28,32)(H,33,34) |
| InChIK | CMWSDHAXCAXGNP-UHFFFAOYSA-N |
| TotalMolweight | 521.984 |
| Molweight | 521.984 |
| MonoisotopicMass | 521.092452 |
| CLogP | 4.1978 |
| CLogS | -8.945 |
| H Acceptors | 9 |
| H Donors | 2 |
| TotalSurfaceArea | 387.76 |
| Relative PSA | 0.30547 |
| PolarSurfaceArea | 144 |
| Druglikeness | 5.3898 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.52778 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 10 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 23 |
| Sp3Atoms | 5 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[2-[(Z)-[[2-[[4-(4-chlorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]phenoxy]acetic acid | 2 - 2-[2-[(Z)-[[2-[[4-(4-chlorophenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]hydrazinylidene]methyl]phenoxy]acetic acid