| MolName | [4-bromo-2-[(Z)-[[(3S)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]hydrazinylidene]methyl]phenyl] 4-nitrobenzoate |
| MolecularFormula | C23H16N3O7Br |
| Smiles | [O-][N+](c(cc1)ccc1C(Oc(cc1)c(/C=N\NC([C@H]2Oc(cccc3)c3OC2)=O)cc1Br)=O)=O |
| InChI | InChI=1S/C23H16BrN3O7/c24-16-7-10-18(34-23(29)14-5-8-17(9-6-14)27(30)31)15(11-16)12-25-26-22(28)21-13-32-19-3-1-2-4-20(19)33-21/h1-12,21H,13H2,(H,26,28)/t21-/m0/s1 |
| InChIK | CMYPIZHDKRENTK-NRFANRHFSA-N |
| TotalMolweight | 526.298 |
| Molweight | 526.298 |
| MonoisotopicMass | 525.017163 |
| CLogP | 3.9778 |
| CLogS | -6.507 |
| H Acceptors | 10 |
| H Donors | 1 |
| TotalSurfaceArea | 349.56 |
| Relative PSA | 0.31317 |
| PolarSurfaceArea | 132.04 |
| Druglikeness | -2.1409 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.58824 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| StereoCenters | 1 |
| Rotatable Bond | 7 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 6 |
| Symmetricatoms | 2 |
| AcidicOxygens | 1 |
| StereoCon | this enantiomer |
Click to Load Molecule:
1 - [4-bromo-2-[(Z)-[[(3S)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]hydrazinylidene]methyl]phenyl] 4-nitrobenzoate | 2 - [4-bromo-2-[(Z)-[[(3S)-2,3-dihydro-1,4-benzodioxine-3-carbonyl]hydrazinylidene]methyl]phenyl] 4-nitrobenzoate