| MolName | N-[(Z)-[4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]naphthalene-2-sulfonamide |
| MolecularFormula | C24H19N2O3FS |
| Smiles | O=S(c1cc2ccccc2cc1)(N/N=C\c(cc1)ccc1OCc(cc1)ccc1F)=O |
| InChI | InChI=1S/C24H19FN2O3S/c25-22-10-5-19(6-11-22)17-30-23-12-7-18(8-13-23)16-26-27-31(28,29)24-14-9-20-3-1-2-4-21(20)15-24/h1-16,27H,17H2 |
| InChIK | CMZRKMXEUUOAHZ-UHFFFAOYSA-N |
| TotalMolweight | 434.49 |
| Molweight | 434.49 |
| MonoisotopicMass | 434.110041 |
| CLogP | 4.9204 |
| CLogS | -5.177 |
| H Acceptors | 5 |
| H Donors | 1 |
| TotalSurfaceArea | 322.29 |
| Relative PSA | 0.19098 |
| PolarSurfaceArea | 76.14 |
| Druglikeness | 0.24783 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.67742 |
| Fragments | 1 |
| Non HAtoms | 31 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 6 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 22 |
| Sp3Atoms | 3 |
| Symmetricatoms | 5 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]naphthalene-2-sulfonamide | 2 - N-[(Z)-[4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]naphthalene-2-sulfonamide