| MolName | N-[(E)-(3-nitrophenyl)methylideneamino]-1H-indole-7-carboxamide |
| MolecularFormula | C16H12N4O3 |
| Smiles | [O-][N+](c1cc(/C=N/NC(c2c3[nH]ccc3ccc2)=O)ccc1)=O |
| InChI | InChI=1S/C16H12N4O3/c21-16(14-6-2-4-12-7-8-17-15(12)14)19-18-10-11-3-1-5-13(9-11)20(22)23/h1-10,17H,(H,19,21) |
| InChIK | CNSBVLDLBBVAKM-UHFFFAOYSA-N |
| TotalMolweight | 308.296 |
| Molweight | 308.296 |
| MonoisotopicMass | 308.090941 |
| CLogP | 2.3194 |
| CLogS | -4.706 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 234.83 |
| Relative PSA | 0.34246 |
| PolarSurfaceArea | 103.07 |
| Druglikeness | -0.57637 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.56522 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 4 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Sp3Atoms | 1 |
| Aromatic Nitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(E)-(3-nitrophenyl)methylideneamino]-1H-indole-7-carboxamide | 2 - N-[(E)-(3-nitrophenyl)methylideneamino]-1H-indole-7-carboxamide