| MolName | 1-(4-chlorophenyl)-3-[(Z)-[6-(4-chlorophenyl)sulfanylimidazo[2,1-b][1,3]thiazol-5-yl]methylideneamino]thiourea |
| MolecularFormula | C19H13N5Cl2S3 |
| Smiles | S=C(Nc(cc1)ccc1Cl)N/N=C\c(n(ccs1)c1n1)c1Sc(cc1)ccc1Cl |
| InChI | InChI=1S/C19H13Cl2N5S3/c20-12-1-5-14(6-2-12)23-18(27)25-22-11-16-17(24-19-26(16)9-10-28-19)29-15-7-3-13(21)4-8-15/h1-11H,(H2,23,25,27) |
| InChIK | COIJABDCLZNMPV-UHFFFAOYSA-N |
| TotalMolweight | 478.451 |
| Molweight | 478.451 |
| MonoisotopicMass | 476.971009 |
| CLogP | 5.8499 |
| CLogS | -6.117 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 341.45 |
| Relative PSA | 0.3491 |
| PolarSurfaceArea | 139.35 |
| Druglikeness | 3.9063 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.62069 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 5 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 20 |
| Sp3Atoms | 2 |
| Symmetricatoms | 4 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 1-(4-chlorophenyl)-3-[(Z)-[6-(4-chlorophenyl)sulfanylimidazo[2,1-b][1,3]thiazol-5-yl]methylideneamino]thiourea | 2 - 1-(4-chlorophenyl)-3-[(Z)-[6-(4-chlorophenyl)sulfanylimidazo[2,1-b][1,3]thiazol-5-yl]methylideneamino]thiourea