| MolName | 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]-N-[(Z)-3-phenylpropylideneamino]acetamide |
| MolecularFormula | C14H16N6O3 |
| Smiles | O=C(CNC(C(N1)=O)=NNC1=O)N/N=C\CCc1ccccc1 |
| InChI | InChI=1S/C14H16N6O3/c21-11(9-15-12-13(22)17-14(23)20-19-12)18-16-8-4-7-10-5-2-1-3-6-10/h1-3,5-6,8H,4,7,9H2,(H,15,19)(H,18,21)(H2,17,20,22,23) |
| InChIK | COJAZYNYJCSJKR-UHFFFAOYSA-N |
| TotalMolweight | 316.32 |
| Molweight | 316.32 |
| MonoisotopicMass | 316.128389 |
| CLogP | -0.5138 |
| CLogS | -3.093 |
| H Acceptors | 9 |
| H Donors | 4 |
| TotalSurfaceArea | 247.86 |
| Relative PSA | 0.43565 |
| PolarSurfaceArea | 124.05 |
| Druglikeness | 5.6889 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.73913 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]-N-[(Z)-3-phenylpropylideneamino]acetamide | 2 - 2-[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]-N-[(Z)-3-phenylpropylideneamino]acetamide