| MolName | 4-(trifluoromethyl)-N-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]aniline |
| MolecularFormula | C15H10N2F6 |
| Smiles | FC(c1ccc(/C=N\Nc2ccc(C(F)(F)F)cc2)cc1)(F)F |
| InChI | InChI=1S/C15H10F6N2/c16-14(17,18)11-3-1-10(2-4-11)9-22-23-13-7-5-12(6-8-13)15(19,20)21/h1-9,23H |
| InChIK | COQDTRCQPZBWOC-UHFFFAOYSA-N |
| TotalMolweight | 332.246 |
| Molweight | 332.246 |
| MonoisotopicMass | 332.074816 |
| CLogP | 6.5375 |
| CLogS | -4.705 |
| H Acceptors | 2 |
| H Donors | 1 |
| TotalSurfaceArea | 228.16 |
| Relative PSA | 0.10067 |
| PolarSurfaceArea | 24.39 |
| Druglikeness | -4.7675 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.65217 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| Symmetricatoms | 8 |
| StereoCon |
Click to Load Molecule:
1 - 4-(trifluoromethyl)-N-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]aniline | 2 - 4-(trifluoromethyl)-N-[(Z)-[4-(trifluoromethyl)phenyl]methylideneamino]aniline