| MolName | N-[(Z)-[1-(4-nitrophenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]pyridine-3-carboxamide |
| MolecularFormula | C29H21N5O3 |
| Smiles | [O-][N+](c(cc1)ccc1-n1c(-c2ccccc2)c(/C=N\NC(c2cnccc2)=O)cc1-c1ccccc1)=O |
| InChI | InChI=1S/C29H21N5O3/c35-29(23-12-7-17-30-19-23)32-31-20-24-18-27(21-8-3-1-4-9-21)33(28(24)22-10-5-2-6-11-22)25-13-15-26(16-14-25)34(36)37/h1-20H,(H,32,35) |
| InChIK | COYTYZOIZWFZIL-UHFFFAOYSA-N |
| TotalMolweight | 487.518 |
| Molweight | 487.518 |
| MonoisotopicMass | 487.16444 |
| CLogP | 4.9644 |
| CLogS | -9.255 |
| H Acceptors | 8 |
| H Donors | 1 |
| TotalSurfaceArea | 377.9 |
| Relative PSA | 0.223 |
| PolarSurfaceArea | 105.1 |
| Druglikeness | 0.44569 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.45946 |
| Fragments | 1 |
| Non HAtoms | 37 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 7 |
| Rings Closures | 5 |
| Small Rings | 5 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 29 |
| Sp3Atoms | 1 |
| Symmetricatoms | 6 |
| Aromatic Nitrogens | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[1-(4-nitrophenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]pyridine-3-carboxamide | 2 - N-[(Z)-[1-(4-nitrophenyl)-2,5-diphenylpyrrol-3-yl]methylideneamino]pyridine-3-carboxamide