| MolName | N-[(Z)-3-cyclohexylpropylideneamino]benzamide |
| MolecularFormula | C16H22N2O |
| Smiles | O=C(c1ccccc1)N/N=C\CCC1CCCCC1 |
| InChI | InChI=1S/C16H22N2O/c19-16(15-11-5-2-6-12-15)18-17-13-7-10-14-8-3-1-4-9-14/h2,5-6,11-14H,1,3-4,7-10H2,(H,18,19) |
| InChIK | COZQFVUCJNNOEW-UHFFFAOYSA-N |
| TotalMolweight | 258.364 |
| Molweight | 258.364 |
| MonoisotopicMass | 258.173213 |
| CLogP | 3.6998 |
| CLogS | -4.339 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 222.55 |
| Relative PSA | 0.16181 |
| PolarSurfaceArea | 41.46 |
| Druglikeness | -0.46332 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.73684 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 3 |
| Electronegative Atoms | 3 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 1 |
| Aromatic Atoms | 6 |
| Sp3Atoms | 8 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-3-cyclohexylpropylideneamino]benzamide | 2 - N-[(Z)-3-cyclohexylpropylideneamino]benzamide