| MolName | [4-bromo-2-[(Z)-[(5-bromo-2-phenylmethoxybenzoyl)hydrazinylidene]methyl]phenyl] benzoate |
| MolecularFormula | C28H20N2O4Br2 |
| Smiles | O=C(c(cc(cc1)Br)c1OCc1ccccc1)N/N=C\c(cc(cc1)Br)c1OC(c1ccccc1)=O |
| InChI | InChI=1S/C28H20Br2N2O4/c29-22-11-13-25(36-28(34)20-9-5-2-6-10-20)21(15-22)17-31-32-27(33)24-16-23(30)12-14-26(24)35-18-19-7-3-1-4-8-19/h1-17H,18H2,(H,32,33) |
| InChIK | CPHTYBNBKDJBEX-UHFFFAOYSA-N |
| TotalMolweight | 608.285 |
| Molweight | 608.285 |
| MonoisotopicMass | 605.97898 |
| CLogP | 7.4306 |
| CLogS | -8.2 |
| H Acceptors | 6 |
| H Donors | 1 |
| TotalSurfaceArea | 395.28 |
| Relative PSA | 0.17469 |
| PolarSurfaceArea | 76.99 |
| Druglikeness | 1.9957 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.55556 |
| Fragments | 1 |
| Non HAtoms | 36 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 9 |
| Rings Closures | 4 |
| Small Rings | 4 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 24 |
| Sp3Atoms | 3 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - [4-bromo-2-[(Z)-[(5-bromo-2-phenylmethoxybenzoyl)hydrazinylidene]methyl]phenyl] benzoate | 2 - [4-bromo-2-[(Z)-[(5-bromo-2-phenylmethoxybenzoyl)hydrazinylidene]methyl]phenyl] benzoate