| MolName | 1-(2,4-dichlorophenyl)-3-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]thiourea |
| MolecularFormula | C16H12N4O2Cl2S |
| Smiles | [O-][N+](c1c(/C=C/C=N\NC(Nc(ccc(Cl)c2)c2Cl)=S)cccc1)=O |
| InChI | InChI=1S/C16H12Cl2N4O2S/c17-12-7-8-14(13(18)10-12)20-16(25)21-19-9-3-5-11-4-1-2-6-15(11)22(23)24/h1-10H,(H2,20,21,25) |
| InChIK | CPUDUVMCZGJRNN-UHFFFAOYSA-N |
| TotalMolweight | 395.269 |
| Molweight | 395.269 |
| MonoisotopicMass | 394.0058 |
| CLogP | 3.9009 |
| CLogS | -6.545 |
| H Acceptors | 6 |
| H Donors | 2 |
| TotalSurfaceArea | 294.42 |
| Relative PSA | 0.31537 |
| PolarSurfaceArea | 114.33 |
| Druglikeness | -2.8361 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.64 |
| Fragments | 1 |
| Non HAtoms | 25 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 2 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 1-(2,4-dichlorophenyl)-3-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]thiourea | 2 - 1-(2,4-dichlorophenyl)-3-[(Z)-[(E)-3-(2-nitrophenyl)prop-2-enylidene]amino]thiourea