| MolName | N-[(Z)-[4-[bis(2-chloroethyl)amino]phenyl]methylideneamino]-4-chloro-2-(4-chloroanilino)benzamide |
| MolecularFormula | C24H22N4OCl4 |
| Smiles | O=C(c(ccc(Cl)c1)c1Nc(cc1)ccc1Cl)N/N=C\c(cc1)ccc1N(CCCl)CCCl |
| InChI | InChI=1S/C24H22Cl4N4O/c25-11-13-32(14-12-26)21-8-1-17(2-9-21)16-29-31-24(33)22-10-5-19(28)15-23(22)30-20-6-3-18(27)4-7-20/h1-10,15-16,30H,11-14H2,(H,31,33) |
| InChIK | CQKLUIZHUNLAAV-UHFFFAOYSA-N |
| TotalMolweight | 524.278 |
| Molweight | 524.278 |
| MonoisotopicMass | 522.054769 |
| CLogP | 7.1116 |
| CLogS | -8.209 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 385.23 |
| Relative PSA | 0.13244 |
| PolarSurfaceArea | 56.73 |
| Druglikeness | 7.4714 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.60606 |
| Fragments | 1 |
| Non HAtoms | 33 |
| NonCHAtoms | 9 |
| Electronegative Atoms | 9 |
| Rotatable Bond | 10 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 18 |
| Sp3Atoms | 4 |
| Symmetricatoms | 7 |
| Amines | 2 |
| Aromatic Amines | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[4-[bis(2-chloroethyl)amino]phenyl]methylideneamino]-4-chloro-2-(4-chloroanilino)benzamide | 2 - N-[(Z)-[4-[bis(2-chloroethyl)amino]phenyl]methylideneamino]-4-chloro-2-(4-chloroanilino)benzamide