| MolName | 5-(1-adamantyl)-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]-1H-pyrazole-3-carboxamide |
| MolecularFormula | C23H26N4O |
| Smiles | O=C(c1n[nH]c(C2(CC(C3)C4)CC4CC3C2)c1)N/N=C\C=C\c1ccccc1 |
| InChI | InChI=1S/C23H26N4O/c28-22(27-24-8-4-7-16-5-2-1-3-6-16)20-12-21(26-25-20)23-13-17-9-18(14-23)11-19(10-17)15-23/h1-8,12,17-19H,9-11,13-15H2,(H,25,26)(H,27,28) |
| InChIK | CQKVIVCEZLEEOR-UHFFFAOYSA-N |
| TotalMolweight | 374.486 |
| Molweight | 374.486 |
| MonoisotopicMass | 374.210661 |
| CLogP | 3.3518 |
| CLogS | -5.342 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 291.79 |
| Relative PSA | 0.20895 |
| PolarSurfaceArea | 70.14 |
| Druglikeness | 6.1533 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.60714 |
| Fragments | 1 |
| Non HAtoms | 28 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 5 |
| Rings Closures | 5 |
| Small Rings | 6 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 11 |
| Sp3Atoms | 10 |
| Symmetricatoms | 8 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - 5-(1-adamantyl)-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]-1H-pyrazole-3-carboxamide | 2 - 5-(1-adamantyl)-N-[(Z)-[(E)-3-phenylprop-2-enylidene]amino]-1H-pyrazole-3-carboxamide