| MolName | 4-[(2,2-dioxo-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)methyl]-N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]benzamide |
| MolecularFormula | C32H25N3O4S |
| Smiles | O=C(c1ccc(CN(c2c(c3ccc4)c4ccc2)S3(=O)=O)cc1)N/N=C\c1cc(OCc2ccccc2)ccc1 |
| InChI | InChI=1S/C32H25N3O4S/c36-32(34-33-20-25-9-4-12-28(19-25)39-22-24-7-2-1-3-8-24)27-17-15-23(16-18-27)21-35-29-13-5-10-26-11-6-14-30(31(26)29)40(35,37)38/h1-20H,21-22H2,(H,34,36) |
| InChIK | CQOBIJPSUPDQGS-UHFFFAOYSA-N |
| TotalMolweight | 547.634 |
| Molweight | 547.634 |
| MonoisotopicMass | 547.156577 |
| CLogP | 6.1447 |
| CLogS | -8.348 |
| H Acceptors | 7 |
| H Donors | 1 |
| TotalSurfaceArea | 404.01 |
| Relative PSA | 0.19341 |
| PolarSurfaceArea | 96.45 |
| Druglikeness | -4.5288 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.575 |
| Fragments | 1 |
| Non HAtoms | 40 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 8 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 5 |
| Aromatic Atoms | 28 |
| Sp3Atoms | 4 |
| Symmetricatoms | 5 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(2,2-dioxo-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)methyl]-N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]benzamide | 2 - 4-[(2,2-dioxo-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaen-3-yl)methyl]-N-[(Z)-(3-phenylmethoxyphenyl)methylideneamino]benzamide