| MolName | N-[(Z)-(4-fluorophenyl)methylideneamino]thieno[2,3-d]pyrimidin-4-amine |
| MolecularFormula | C13H9N4FS |
| Smiles | Fc1ccc(/C=N\Nc2c(ccs3)c3ncn2)cc1 |
| InChI | InChI=1S/C13H9FN4S/c14-10-3-1-9(2-4-10)7-17-18-12-11-5-6-19-13(11)16-8-15-12/h1-8H,(H,15,16,18) |
| InChIK | CSOVGIFAOYFLPA-UHFFFAOYSA-N |
| TotalMolweight | 272.306 |
| Molweight | 272.306 |
| MonoisotopicMass | 272.053194 |
| CLogP | 4.7653 |
| CLogS | -4.95 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 203.65 |
| Relative PSA | 0.3205 |
| PolarSurfaceArea | 78.41 |
| Druglikeness | 1.2313 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.63158 |
| Fragments | 1 |
| Non HAtoms | 19 |
| NonCHAtoms | 6 |
| Electronegative Atoms | 6 |
| Rotatable Bond | 3 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 15 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-(4-fluorophenyl)methylideneamino]thieno[2,3-d]pyrimidin-4-amine | 2 - N-[(Z)-(4-fluorophenyl)methylideneamino]thieno[2,3-d]pyrimidin-4-amine