| MolName | N-[(Z)-anthracen-9-ylmethylideneamino]-2-[[5-[(naphthalen-1-ylamino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| MolecularFormula | C36H28N6OS |
| Smiles | O=C(CSc1nnc(CNc2cccc3ccccc23)n1-c1ccccc1)N/N=C\c1c(cccc2)c2cc2ccccc12 |
| InChI | InChI=1S/C36H28N6OS/c43-35(40-38-22-32-29-17-7-5-12-26(29)21-27-13-6-8-18-30(27)32)24-44-36-41-39-34(42(36)28-15-2-1-3-16-28)23-37-33-20-10-14-25-11-4-9-19-31(25)33/h1-22,37H,23-24H2,(H,40,43) |
| InChIK | CSZAVTMVRCMFLD-UHFFFAOYSA-N |
| TotalMolweight | 592.725 |
| Molweight | 592.725 |
| MonoisotopicMass | 592.204529 |
| CLogP | 7.4266 |
| CLogS | -11.756 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 453.5 |
| Relative PSA | 0.20677 |
| PolarSurfaceArea | 109.5 |
| Druglikeness | 5.8676 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.47727 |
| Fragments | 1 |
| Non HAtoms | 44 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 9 |
| Rings Closures | 7 |
| Small Rings | 7 |
| Aromatic Rings | 7 |
| Aromatic Atoms | 35 |
| Sp3Atoms | 3 |
| Symmetricatoms | 8 |
| Amines | 1 |
| Aromatic Amines | 1 |
| Aromatic Nitrogens | 3 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-anthracen-9-ylmethylideneamino]-2-[[5-[(naphthalen-1-ylamino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide | 2 - N-[(Z)-anthracen-9-ylmethylideneamino]-2-[[5-[(naphthalen-1-ylamino)methyl]-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide