| MolName | N-(furan-2-ylmethyl)-2-[4-[(Z)-(phenylcarbamoylhydrazinylidene)methyl]phenoxy]acetamide |
| MolecularFormula | C21H20N4O4 |
| Smiles | O=C(COc1ccc(/C=N\NC(Nc2ccccc2)=O)cc1)NCc1ccco1 |
| InChI | InChI=1S/C21H20N4O4/c26-20(22-14-19-7-4-12-28-19)15-29-18-10-8-16(9-11-18)13-23-25-21(27)24-17-5-2-1-3-6-17/h1-13H,14-15H2,(H,22,26)(H2,24,25,27) |
| InChIK | CTGYBCKVMISOBB-UHFFFAOYSA-N |
| TotalMolweight | 392.414 |
| Molweight | 392.414 |
| MonoisotopicMass | 392.148456 |
| CLogP | 2.816 |
| CLogS | -5.027 |
| H Acceptors | 8 |
| H Donors | 3 |
| TotalSurfaceArea | 314.63 |
| Relative PSA | 0.30537 |
| PolarSurfaceArea | 104.96 |
| Druglikeness | 4.7244 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.72414 |
| Fragments | 1 |
| Non HAtoms | 29 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 8 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 3 |
| Symmetricatoms | 4 |
| Amides | 2 |
| StereoCon |
Click to Load Molecule:
1 - N-(furan-2-ylmethyl)-2-[4-[(Z)-(phenylcarbamoylhydrazinylidene)methyl]phenoxy]acetamide | 2 - N-(furan-2-ylmethyl)-2-[4-[(Z)-(phenylcarbamoylhydrazinylidene)methyl]phenoxy]acetamide