| MolName | 2-[(Z)-anthracen-9-ylmethylideneamino]-N-cyclohexyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| MolecularFormula | C30H30N2OS |
| Smiles | O=C(c1c(/N=C\c2c(cccc3)c3cc3ccccc23)sc2c1CCCC2)NC1CCCCC1 |
| InChI | InChI=1S/C30H30N2OS/c33-29(32-22-12-2-1-3-13-22)28-25-16-8-9-17-27(25)34-30(28)31-19-26-23-14-6-4-10-20(23)18-21-11-5-7-15-24(21)26/h4-7,10-11,14-15,18-19,22H,1-3,8-9,12-13,16-17H2,(H,32,33) |
| InChIK | CUKIMNCENAPBHV-UHFFFAOYSA-N |
| TotalMolweight | 466.647 |
| Molweight | 466.647 |
| MonoisotopicMass | 466.207883 |
| CLogP | 7.6297 |
| CLogS | -9.201 |
| H Acceptors | 3 |
| H Donors | 1 |
| TotalSurfaceArea | 361.47 |
| Relative PSA | 0.15595 |
| PolarSurfaceArea | 69.7 |
| Druglikeness | 0.33565 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | high |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.44118 |
| Fragments | 1 |
| Non HAtoms | 34 |
| NonCHAtoms | 4 |
| Electronegative Atoms | 4 |
| Rotatable Bond | 4 |
| Rings Closures | 6 |
| Small Rings | 6 |
| Aromatic Rings | 4 |
| Aromatic Atoms | 19 |
| Sp3Atoms | 10 |
| Symmetricatoms | 8 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(Z)-anthracen-9-ylmethylideneamino]-N-cyclohexyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide | 2 - 2-[(Z)-anthracen-9-ylmethylideneamino]-N-cyclohexyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide