| MolName | 4-[(2Z)-2-[(Z)-2-chloro-3-phenylprop-2-enylidene]hydrazinyl]benzenesulfonamide |
| MolecularFormula | C15H14N3O2ClS |
| Smiles | NS(c(cc1)ccc1N/N=C\C(\Cl)=C\c1ccccc1)(=O)=O |
| InChI | InChI=1S/C15H14ClN3O2S/c16-13(10-12-4-2-1-3-5-12)11-18-19-14-6-8-15(9-7-14)22(17,20)21/h1-11,19H,(H2,17,20,21) |
| InChIK | CUKLZJNWOZHPFM-UHFFFAOYSA-N |
| TotalMolweight | 335.814 |
| Molweight | 335.814 |
| MonoisotopicMass | 335.049524 |
| CLogP | 4.0848 |
| CLogS | -4.031 |
| H Acceptors | 5 |
| H Donors | 2 |
| TotalSurfaceArea | 246.47 |
| Relative PSA | 0.27111 |
| PolarSurfaceArea | 92.93 |
| Druglikeness | 3.0369 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | imine/hydrazone of aldehyde |
| Shape Index | 0.68182 |
| Fragments | 1 |
| Non HAtoms | 22 |
| NonCHAtoms | 7 |
| Electronegative Atoms | 7 |
| Rotatable Bond | 5 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 1 |
| Symmetricatoms | 5 |
| Amides | 1 |
| StereoCon |
Click to Load Molecule:
1 - 4-[(2Z)-2-[(Z)-2-chloro-3-phenylprop-2-enylidene]hydrazinyl]benzenesulfonamide | 2 - 4-[(2Z)-2-[(Z)-2-chloro-3-phenylprop-2-enylidene]hydrazinyl]benzenesulfonamide