| MolName | (Z)-1-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]-3-nitrophenyl]-N-(1,2,4-triazol-4-yl)methanimine |
| MolecularFormula | C16H10N5O3BrCl2 |
| Smiles | [O-][N+](c(cc(cc1/C=N\n2cnnc2)Br)c1OCc(ccc(Cl)c1)c1Cl)=O |
| InChI | InChI=1S/C16H10BrCl2N5O3/c17-12-3-11(6-22-23-8-20-21-9-23)16(15(4-12)24(25)26)27-7-10-1-2-13(18)5-14(10)19/h1-6,8-9H,7H2 |
| InChIK | CUNYSMXNIZAMNB-UHFFFAOYSA-N |
| TotalMolweight | 471.097 |
| Molweight | 471.097 |
| MonoisotopicMass | 468.934405 |
| CLogP | 3.592 |
| CLogS | -8.417 |
| H Acceptors | 8 |
| TotalSurfaceArea | 301.16 |
| Relative PSA | 0.2681 |
| PolarSurfaceArea | 98.12 |
| Druglikeness | -3.9089 |
| Mutagenic | none |
| Tumorigenic | none |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.51852 |
| Fragments | 1 |
| Non HAtoms | 27 |
| NonCHAtoms | 11 |
| Electronegative Atoms | 11 |
| Rotatable Bond | 6 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 3 |
| Symmetricatoms | 2 |
| Aromatic Nitrogens | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - (Z)-1-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]-3-nitrophenyl]-N-(1,2,4-triazol-4-yl)methanimine | 2 - (Z)-1-[5-bromo-2-[(2,4-dichlorophenyl)methoxy]-3-nitrophenyl]-N-(1,2,4-triazol-4-yl)methanimine