| MolName | N,N'-bis[(Z)-(5-iodofuran-2-yl)methylideneamino]propanediamide |
| MolecularFormula | C13H10N4O4I2 |
| Smiles | O=C(CC(N/N=C\c(o1)ccc1I)=O)N/N=C\c(o1)ccc1I |
| InChI | InChI=1S/C13H10I2N4O4/c14-10-3-1-8(22-10)6-16-18-12(20)5-13(21)19-17-7-9-2-4-11(15)23-9/h1-4,6-7H,5H2,(H,18,20)(H,19,21) |
| InChIK | CUXBFWLPYXOEFS-UHFFFAOYSA-N |
| TotalMolweight | 540.046 |
| Molweight | 540.046 |
| MonoisotopicMass | 539.879152 |
| CLogP | 2.4392 |
| CLogS | -5.31 |
| H Acceptors | 8 |
| H Donors | 2 |
| TotalSurfaceArea | 286.66 |
| Relative PSA | 0.34968 |
| PolarSurfaceArea | 109.2 |
| Druglikeness | 3.9789 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.73913 |
| Fragments | 1 |
| Non HAtoms | 23 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 6 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 10 |
| Sp3Atoms | 1 |
| Symmetricatoms | 11 |
| StereoCon |
Click to Load Molecule:
1 - N,N'-bis[(Z)-(5-iodofuran-2-yl)methylideneamino]propanediamide | 2 - N,N'-bis[(Z)-(5-iodofuran-2-yl)methylideneamino]propanediamide