| MolName | 2-[(Z)-[(2,4-dichlorophenyl)carbamothioylhydrazinylidene]methyl]-4-nitrophenolate |
| MolecularFormula | C14H9N4O3Cl2S |
| Smiles | [O-]c(cc1)c(/C=N\NC(Nc(ccc(Cl)c2)c2Cl)=S)cc1[N+]([O-])=O |
| InChI | InChI=1S/C14H10Cl2N4O3S/c15-9-1-3-12(11(16)6-9)18-14(24)19-17-7-8-5-10(20(22)23)2-4-13(8)21/h1-7,21H,(H2,18,19,24)/p-1 |
| InChIK | CVBMRBHBZOHUCX-UHFFFAOYSA-M |
| TotalMolweight | 384.222 |
| Molweight | 384.222 |
| MonoisotopicMass | 382.97724 |
| CLogP | 1.9589 |
| CLogS | -5.957 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 275.45 |
| Relative PSA | 0.38893 |
| PolarSurfaceArea | 137.39 |
| Druglikeness | -2.9677 |
| Mutagenic | high |
| Tumorigenic | none |
| Reproductive Effective | high |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde; thio-amide/urea |
| Shape Index | 0.625 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 10 |
| Electronegative Atoms | 10 |
| Rotatable Bond | 4 |
| Rings Closures | 2 |
| Small Rings | 2 |
| Aromatic Rings | 2 |
| Aromatic Atoms | 12 |
| Sp3Atoms | 3 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 2-[(Z)-[(2,4-dichlorophenyl)carbamothioylhydrazinylidene]methyl]-4-nitrophenolate | 2 - 2-[(Z)-[(2,4-dichlorophenyl)carbamothioylhydrazinylidene]methyl]-4-nitrophenolate