| MolName | N-[(Z)-[5-(4-iodophenyl)furan-2-yl]methylideneamino]-2-phenylacetamide |
| MolecularFormula | C19H15N2O2I |
| Smiles | O=C(Cc1ccccc1)N/N=C\c1ccc(-c(cc2)ccc2I)o1 |
| InChI | InChI=1S/C19H15IN2O2/c20-16-8-6-15(7-9-16)18-11-10-17(24-18)13-21-22-19(23)12-14-4-2-1-3-5-14/h1-11,13H,12H2,(H,22,23) |
| InChIK | CVGFTRZWUPYTBS-UHFFFAOYSA-N |
| TotalMolweight | 430.24 |
| Molweight | 430.24 |
| MonoisotopicMass | 430.017826 |
| CLogP | 4.5757 |
| CLogS | -6.162 |
| H Acceptors | 4 |
| H Donors | 1 |
| TotalSurfaceArea | 276.48 |
| Relative PSA | 0.18128 |
| PolarSurfaceArea | 54.6 |
| Druglikeness | 6.8389 |
| Mutagenic | high |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | acyl-hydrazone; imine/hydrazone of aldehyde |
| Shape Index | 0.70833 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 5 |
| Electronegative Atoms | 5 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 1 |
| Symmetricatoms | 4 |
| StereoCon |
Click to Load Molecule:
1 - N-[(Z)-[5-(4-iodophenyl)furan-2-yl]methylideneamino]-2-phenylacetamide | 2 - N-[(Z)-[5-(4-iodophenyl)furan-2-yl]methylideneamino]-2-phenylacetamide