| MolName | 3-[(E)-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenol |
| MolecularFormula | C16H12N4O3S |
| Smiles | [O-][N+](c1cccc(-c2csc(N/N=C/c3cc(O)ccc3)n2)c1)=O |
| InChI | InChI=1S/C16H12N4O3S/c21-14-6-1-3-11(7-14)9-17-19-16-18-15(10-24-16)12-4-2-5-13(8-12)20(22)23/h1-10,21H,(H,18,19) |
| InChIK | CVGPNVWUBSDWKD-UHFFFAOYSA-N |
| TotalMolweight | 340.362 |
| Molweight | 340.362 |
| MonoisotopicMass | 340.063011 |
| CLogP | 4.7787 |
| CLogS | -4.824 |
| H Acceptors | 7 |
| H Donors | 2 |
| TotalSurfaceArea | 253.72 |
| Relative PSA | 0.38554 |
| PolarSurfaceArea | 131.57 |
| Druglikeness | -1.3007 |
| Mutagenic | none |
| Tumorigenic | high |
| Reproductive Effective | none |
| Irritant | none |
| Nasty Functions | aromatic nitro; imine/hydrazone of aldehyde |
| Shape Index | 0.625 |
| Fragments | 1 |
| Non HAtoms | 24 |
| NonCHAtoms | 8 |
| Electronegative Atoms | 8 |
| Rotatable Bond | 5 |
| Rings Closures | 3 |
| Small Rings | 3 |
| Aromatic Rings | 3 |
| Aromatic Atoms | 17 |
| Sp3Atoms | 2 |
| Aromatic Nitrogens | 1 |
| BasicNitrogens | 1 |
| AcidicOxygens | 1 |
| StereoCon |
Click to Load Molecule:
1 - 3-[(E)-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenol | 2 - 3-[(E)-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]hydrazinylidene]methyl]phenol